C24H25N3O2 — CID 25398392
N-[2-[4-(3-methylphenyl)piperazin-1-yl]-2-oxoethyl]naphthalene-2-carboxamide (PubChem CID 25398392) has the molecular formula C24H25N3O2 and a molecular weight of 387.48 g/mol. Its IUPAC name is N-[2-[4-(3-methylphenyl)piperazin-1-yl]-2-oxoethyl]naphthalene-2-carboxamide.
| Compound Name | N-[2-[4-(3-methylphenyl)piperazin-1-yl]-2-oxoethyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 25398392 |
| Molecular Formula | C24H25N3O2 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | N-[2-[4-(3-methylphenyl)piperazin-1-yl]-2-oxoethyl]naphthalene-2-carboxamide |
| SMILES | Cc1cccc(N2CCN(C(=O)CNC(=O)c3ccc4ccccc4c3)CC2)c1 |
| InChI | InChI=1S/C24H25N3O2/c1-18-5-4-8-22(15-18)26-11-13-27(14-12-26)23(28)17-25-24(29)21-10-9-19-6-2-3-7-20(19)16-21/h2-10,15-16H,11-14,17H2,1H3,(H,25,29) |
| InChIKey | ORUVVAXZASVMGR-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |