C17H14ClNO4 — CID 25400589
2-(2-chlorophenyl)-6-ethoxy-7-methoxy-3,1-benzoxazin-4-one (PubChem CID 25400589) has the molecular formula C17H14ClNO4 and a molecular weight of 331.76 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-6-ethoxy-7-methoxy-3,1-benzoxazin-4-one.
| Compound Name | 2-(2-chlorophenyl)-6-ethoxy-7-methoxy-3,1-benzoxazin-4-one |
|---|---|
| PubChem CID | 25400589 |
| Molecular Formula | C17H14ClNO4 |
| Molecular Weight | 331.76 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | 2-(2-chlorophenyl)-6-ethoxy-7-methoxy-3,1-benzoxazin-4-one |
| SMILES | CCOc1cc2c(=O)oc(-c3ccccc3Cl)nc2cc1OC |
| InChI | InChI=1S/C17H14ClNO4/c1-3-22-15-8-11-13(9-14(15)21-2)19-16(23-17(11)20)10-6-4-5-7-12(10)18/h4-9H,3H2,1-2H3 |
| InChIKey | WYFUNPGYPSDKCF-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.76 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |