C19H16F3N3O4 — CID 25402689
(2S)-4-acetyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide (PubChem CID 25402689) has the molecular formula C19H16F3N3O4 and a molecular weight of 407.35 g/mol. Its IUPAC name is (2S)-4-acetyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide.
| Compound Name | (2S)-4-acetyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 25402689 |
| Molecular Formula | C19H16F3N3O4 |
| Molecular Weight | 407.35 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | (2S)-4-acetyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
| SMILES | CC(=O)N1C[C@@H](C(=O)NCC(=O)Nc2ccc(F)c(F)c2F)Oc2ccccc21 |
| InChI | InChI=1S/C19H16F3N3O4/c1-10(26)25-9-15(29-14-5-3-2-4-13(14)25)19(28)23-8-16(27)24-12-7-6-11(20)17(21)18(12)22/h2-7,15H,8-9H2,1H3,(H,23,28)(H,24,27)/t15-/m0/s1 |
| InChIKey | BAKZTGYWJGBFPA-HNNXBMFYSA-N |
| XLogP | 1.97 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.35 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|