About 5-[(2R)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]-8-nitroisoquinoline
5-[(2R)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]-8-nitroisoquinoline (PubChem CID 25410129) has the molecular formula C21H21N3O4
and a molecular weight of 379.42 g/mol. Its IUPAC name is 5-[(2R)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]-8-nitroisoquinoline.
Molecular Properties
| Compound Name | 5-[(2R)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]-8-nitroisoquinoline |
| PubChem CID | 25410129 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 5-[(2R)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]-8-nitroisoquinoline |
| SMILES | COc1ccc([C@H]2CCCN2c2ccc([N+](=O)[O-])c3cnccc23)c(OC)c1 |
| InChI | InChI=1S/C21H21N3O4/c1-27-14-5-6-16(21(12-14)28-2)18-4-3-11-23(18)19-7-8-20(24(25)26)17-13-22-10-9-15(17)19/h5-10,12-13,18H,3-4,11H2,1-2H3/t18-/m1/s1 |
| InChIKey | ZWUXYDJZVSWVHE-GOSISDBHSA-N |
| XLogP | 4.50 |
| TPSA | 77.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-[(2R)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]-8-nitroisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2R)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]-8-nitroisoquinoline?
The IUPAC name of 5-[(2R)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]-8-nitroisoquinoline (CID 25410129) is 5-[(2R)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]-8-nitroisoquinoline.
What is the SMILES notation for 5-[(2R)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]-8-nitroisoquinoline?
The canonical SMILES for 5-[(2R)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]-8-nitroisoquinoline is COc1ccc([C@H]2CCCN2c2ccc([N+](=O)[O-])c3cnccc23)c(OC)c1.
What is the InChIKey of 5-[(2R)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]-8-nitroisoquinoline?
The InChIKey is ZWUXYDJZVSWVHE-GOSISDBHSA-N. The full InChI is InChI=1S/C21H21N3O4/c1-27-14-5-6-16(21(12-14)28-2)18-4-3-11-23(18)19-7-8-20(24(25)26)17-13-22-10-9-15(17)19/h5-10,12-13,18H,3-4,11H2,1-2H3/t18-/m1/s1.
What are the key properties of 5-[(2R)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]-8-nitroisoquinoline?
5-[(2R)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]-8-nitroisoquinoline has a molecular weight of 379.42 g/mol, XLogP of 4.50, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2R)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]-8-nitroisoquinoline is sourced from PubChem (CID 25410129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).