C25H32N4O6S — CID 25412482
(3R)-N-[(Z)-[4-[2-(ethylamino)-2-oxoethoxy]-3-methoxyphenyl]methylideneamino]-1-(4-methylphenyl)sulfonylpiperidine-3-carboxamide (PubChem CID 25412482) has the molecular formula C25H32N4O6S and a molecular weight of 516.62 g/mol. Its IUPAC name is (3R)-N-[(Z)-[4-[2-(ethylamino)-2-oxoethoxy]-3-methoxyphenyl]methylideneamino]-1-(4-methylphenyl)sulfonylpiperidine-3-carboxamide.
| Compound Name | (3R)-N-[(Z)-[4-[2-(ethylamino)-2-oxoethoxy]-3-methoxyphenyl]methylideneamino]-1-(4-methylphenyl)sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 25412482 |
| Molecular Formula | C25H32N4O6S |
| Molecular Weight | 516.62 g/mol |
| Exact Mass | 516.20 |
| IUPAC Name | (3R)-N-[(Z)-[4-[2-(ethylamino)-2-oxoethoxy]-3-methoxyphenyl]methylideneamino]-1-(4-methylphenyl)sulfonylpiperidine-3-carboxamide |
| SMILES | CCNC(=O)COc1ccc(/C=N\NC(=O)[C@@H]2CCCN(S(=O)(=O)c3ccc(C)cc3)C2)cc1OC |
| InChI | InChI=1S/C25H32N4O6S/c1-4-26-24(30)17-35-22-12-9-19(14-23(22)34-3)15-27-28-25(31)20-6-5-13-29(16-20)36(32,33)21-10-7-18(2)8-11-21/h7-12,14-15,20H,4-6,13,16-17H2,1-3H3,(H,26,30)(H,28,31)/b27-15-/t20-/m1/s1 |
| InChIKey | ZVPADCJKRDRIKZ-UXLQVQPCSA-N |
| XLogP | 2.07 |
| TPSA | 126.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.62 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|