C27H32N6O2 — CID 25412951
2-[(2R)-2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-3-oxopiperazin-1-yl]-N-(4-pyrrolidin-1-ylphenyl)acetamide (PubChem CID 25412951) has the molecular formula C27H32N6O2 and a molecular weight of 472.59 g/mol. Its IUPAC name is 2-[(2R)-2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-3-oxopiperazin-1-yl]-N-(4-pyrrolidin-1-ylphenyl)acetamide.
| Compound Name | 2-[(2R)-2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-3-oxopiperazin-1-yl]-N-(4-pyrrolidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 25412951 |
| Molecular Formula | C27H32N6O2 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | 2-[(2R)-2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-3-oxopiperazin-1-yl]-N-(4-pyrrolidin-1-ylphenyl)acetamide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1[C@@H]1C(=O)NCCN1CC(=O)Nc1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C27H32N6O2/c1-19-25(20(2)33(30-19)23-8-4-3-5-9-23)26-27(35)28-14-17-32(26)18-24(34)29-21-10-12-22(13-11-21)31-15-6-7-16-31/h3-5,8-13,26H,6-7,14-18H2,1-2H3,(H,28,35)(H,29,34)/t26-/m1/s1 |
| InChIKey | ZPDVBZZRUYEPIM-AREMUKBSSA-N |
| XLogP | 3.20 |
| TPSA | 82.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|