About 2-[(2R)-2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-3-oxopiperazin-1-yl]acetamide
2-[(2R)-2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-3-oxopiperazin-1-yl]acetamide (PubChem CID 35878494) has the molecular formula C17H21N5O2
and a molecular weight of 327.39 g/mol. Its IUPAC name is 2-[(2R)-2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-3-oxopiperazin-1-yl]acetamide.
Molecular Properties
| Compound Name | 2-[(2R)-2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-3-oxopiperazin-1-yl]acetamide |
| PubChem CID | 35878494 |
| Molecular Formula | C17H21N5O2 |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | 2-[(2R)-2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-3-oxopiperazin-1-yl]acetamide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1[C@@H]1C(=O)NCCN1CC(N)=O |
| InChI | InChI=1S/C17H21N5O2/c1-11-15(12(2)22(20-11)13-6-4-3-5-7-13)16-17(24)19-8-9-21(16)10-14(18)23/h3-7,16H,8-10H2,1-2H3,(H2,18,23)(H,19,24)/t16-/m1/s1 |
| InChIKey | DEVHDQRGDCXLTP-MRXNPFEDSA-N |
| XLogP | 0.45 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(2R)-2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-3-oxopiperazin-1-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2R)-2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-3-oxopiperazin-1-yl]acetamide?
The IUPAC name of 2-[(2R)-2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-3-oxopiperazin-1-yl]acetamide (CID 35878494) is 2-[(2R)-2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-3-oxopiperazin-1-yl]acetamide.
What is the SMILES notation for 2-[(2R)-2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-3-oxopiperazin-1-yl]acetamide?
The canonical SMILES for 2-[(2R)-2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-3-oxopiperazin-1-yl]acetamide is Cc1nn(-c2ccccc2)c(C)c1[C@@H]1C(=O)NCCN1CC(N)=O.
What is the InChIKey of 2-[(2R)-2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-3-oxopiperazin-1-yl]acetamide?
The InChIKey is DEVHDQRGDCXLTP-MRXNPFEDSA-N. The full InChI is InChI=1S/C17H21N5O2/c1-11-15(12(2)22(20-11)13-6-4-3-5-7-13)16-17(24)19-8-9-21(16)10-14(18)23/h3-7,16H,8-10H2,1-2H3,(H2,18,23)(H,19,24)/t16-/m1/s1.
What are the key properties of 2-[(2R)-2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-3-oxopiperazin-1-yl]acetamide?
2-[(2R)-2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-3-oxopiperazin-1-yl]acetamide has a molecular weight of 327.39 g/mol, XLogP of 0.45, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2R)-2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-3-oxopiperazin-1-yl]acetamide is sourced from PubChem (CID 35878494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).