C20H22Cl2N4O3 — CID 2541352
4-[[2-[[2-(2,5-dichloroanilino)-2-oxoethyl]-propylamino]acetyl]amino]benzamide (PubChem CID 2541352) has the molecular formula C20H22Cl2N4O3 and a molecular weight of 437.33 g/mol. Its IUPAC name is 4-[[2-[[2-(2,5-dichloroanilino)-2-oxoethyl]-propylamino]acetyl]amino]benzamide.
| Compound Name | 4-[[2-[[2-(2,5-dichloroanilino)-2-oxoethyl]-propylamino]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 2541352 |
| Molecular Formula | C20H22Cl2N4O3 |
| Molecular Weight | 437.33 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | 4-[[2-[[2-(2,5-dichloroanilino)-2-oxoethyl]-propylamino]acetyl]amino]benzamide |
| SMILES | CCCN(CC(=O)Nc1ccc(C(N)=O)cc1)CC(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C20H22Cl2N4O3/c1-2-9-26(12-19(28)25-17-10-14(21)5-8-16(17)22)11-18(27)24-15-6-3-13(4-7-15)20(23)29/h3-8,10H,2,9,11-12H2,1H3,(H2,23,29)(H,24,27)(H,25,28) |
| InChIKey | WWZYHKRLDAKGLK-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.33 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |