C20H22ClFN4O3 — CID 8779826
N-(4-acetamidophenyl)-2-[[2-(5-chloro-2-fluoroanilino)-2-oxoethyl]-ethylamino]acetamide (PubChem CID 8779826) has the molecular formula C20H22ClFN4O3 and a molecular weight of 420.87 g/mol. Its IUPAC name is N-(4-acetamidophenyl)-2-[[2-(5-chloro-2-fluoroanilino)-2-oxoethyl]-ethylamino]acetamide.
| Compound Name | N-(4-acetamidophenyl)-2-[[2-(5-chloro-2-fluoroanilino)-2-oxoethyl]-ethylamino]acetamide |
|---|---|
| PubChem CID | 8779826 |
| Molecular Formula | C20H22ClFN4O3 |
| Molecular Weight | 420.87 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | N-(4-acetamidophenyl)-2-[[2-(5-chloro-2-fluoroanilino)-2-oxoethyl]-ethylamino]acetamide |
| SMILES | CCN(CC(=O)Nc1ccc(NC(C)=O)cc1)CC(=O)Nc1cc(Cl)ccc1F |
| InChI | InChI=1S/C20H22ClFN4O3/c1-3-26(12-20(29)25-18-10-14(21)4-9-17(18)22)11-19(28)24-16-7-5-15(6-8-16)23-13(2)27/h4-10H,3,11-12H2,1-2H3,(H,23,27)(H,24,28)(H,25,29) |
| InChIKey | SRGMMZXDNSRCOV-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.87 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |