C22H18Cl2N4O2 — CID 25426951
(2R)-4-[(Z)-(2,4-dichlorophenyl)methylideneamino]-2-methyl-4,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11,13,15-tetraene-3,6-dione (PubChem CID 25426951) has the molecular formula C22H18Cl2N4O2 and a molecular weight of 441.32 g/mol. Its IUPAC name is (2R)-4-[(Z)-(2,4-dichlorophenyl)methylideneamino]-2-methyl-4,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11,13,15-tetraene-3,6-dione.
| Compound Name | (2R)-4-[(Z)-(2,4-dichlorophenyl)methylideneamino]-2-methyl-4,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11,13,15-tetraene-3,6-dione |
|---|---|
| PubChem CID | 25426951 |
| Molecular Formula | C22H18Cl2N4O2 |
| Molecular Weight | 441.32 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | (2R)-4-[(Z)-(2,4-dichlorophenyl)methylideneamino]-2-methyl-4,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11,13,15-tetraene-3,6-dione |
| SMILES | C[C@@]12C(=O)N(/N=C\c3ccc(Cl)cc3Cl)CC(=O)N1CCc1c2[nH]c2ccccc12 |
| InChI | InChI=1S/C22H18Cl2N4O2/c1-22-20-16(15-4-2-3-5-18(15)26-20)8-9-27(22)19(29)12-28(21(22)30)25-11-13-6-7-14(23)10-17(13)24/h2-7,10-11,26H,8-9,12H2,1H3/b25-11-/t22-/m1/s1 |
| InChIKey | GGQFHWDIGKBYSO-SNDOSVFYSA-N |
| XLogP | 3.95 |
| TPSA | 68.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.32 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|