C13H13N3O3 — CID 2542774
N-[2-(methylamino)-2-oxoethyl]-2-oxo-1H-quinoline-4-carboxamide (PubChem CID 2542774) has the molecular formula C13H13N3O3 and a molecular weight of 259.26 g/mol. Its IUPAC name is N-[2-(methylamino)-2-oxoethyl]-2-oxo-1H-quinoline-4-carboxamide.
| Compound Name | N-[2-(methylamino)-2-oxoethyl]-2-oxo-1H-quinoline-4-carboxamide |
|---|---|
| PubChem CID | 2542774 |
| Molecular Formula | C13H13N3O3 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | N-[2-(methylamino)-2-oxoethyl]-2-oxo-1H-quinoline-4-carboxamide |
| SMILES | CNC(=O)CNC(=O)c1cc(=O)[nH]c2ccccc12 |
| InChI | InChI=1S/C13H13N3O3/c1-14-12(18)7-15-13(19)9-6-11(17)16-10-5-3-2-4-8(9)10/h2-6H,7H2,1H3,(H,14,18)(H,15,19)(H,16,17) |
| InChIKey | TXYFFCDGOSTLOH-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |