C19H18N2O3 — CID 111119780
N-[2-hydroxy-2-(2-methylphenyl)ethyl]-2-oxo-1H-quinoline-4-carboxamide (PubChem CID 111119780) has the molecular formula C19H18N2O3 and a molecular weight of 322.36 g/mol. Its IUPAC name is N-[2-hydroxy-2-(2-methylphenyl)ethyl]-2-oxo-1H-quinoline-4-carboxamide.
| Compound Name | N-[2-hydroxy-2-(2-methylphenyl)ethyl]-2-oxo-1H-quinoline-4-carboxamide |
|---|---|
| PubChem CID | 111119780 |
| Molecular Formula | C19H18N2O3 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | N-[2-hydroxy-2-(2-methylphenyl)ethyl]-2-oxo-1H-quinoline-4-carboxamide |
| SMILES | Cc1ccccc1C(O)CNC(=O)c1cc(=O)[nH]c2ccccc12 |
| InChI | InChI=1S/C19H18N2O3/c1-12-6-2-3-7-13(12)17(22)11-20-19(24)15-10-18(23)21-16-9-5-4-8-14(15)16/h2-10,17,22H,11H2,1H3,(H,20,24)(H,21,23) |
| InChIKey | BDCCDUHUDGZGFN-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |