C17H26N4O4 — CID 25442066
4-amino-N-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-methylpropyl]-3-nitrobenzamide (PubChem CID 25442066) has the molecular formula C17H26N4O4 and a molecular weight of 350.42 g/mol. Its IUPAC name is 4-amino-N-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-methylpropyl]-3-nitrobenzamide.
| Compound Name | 4-amino-N-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-methylpropyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 25442066 |
| Molecular Formula | C17H26N4O4 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 4-amino-N-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-methylpropyl]-3-nitrobenzamide |
| SMILES | C[C@@H]1CN(C(C)(C)CNC(=O)c2ccc(N)c([N+](=O)[O-])c2)C[C@H](C)O1 |
| InChI | InChI=1S/C17H26N4O4/c1-11-8-20(9-12(2)25-11)17(3,4)10-19-16(22)13-5-6-14(18)15(7-13)21(23)24/h5-7,11-12H,8-10,18H2,1-4H3,(H,19,22)/t11-,12+ |
| InChIKey | NEILDGDXAVLYLL-TXEJJXNPSA-N |
| XLogP | 1.79 |
| TPSA | 110.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|