C20H24N4O6S2 — CID 25445328
N-(4-ethoxy-3-pyrrolidin-1-ylsulfonylphenyl)-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxamide (PubChem CID 25445328) has the molecular formula C20H24N4O6S2 and a molecular weight of 480.57 g/mol. Its IUPAC name is N-(4-ethoxy-3-pyrrolidin-1-ylsulfonylphenyl)-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxamide.
| Compound Name | N-(4-ethoxy-3-pyrrolidin-1-ylsulfonylphenyl)-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxamide |
|---|---|
| PubChem CID | 25445328 |
| Molecular Formula | C20H24N4O6S2 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | N-(4-ethoxy-3-pyrrolidin-1-ylsulfonylphenyl)-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxamide |
| SMILES | CCOc1ccc(NC(=O)C2=CN3CCS(=O)(=O)N=C3C=C2)cc1S(=O)(=O)N1CCCC1 |
| InChI | InChI=1S/C20H24N4O6S2/c1-2-30-17-7-6-16(13-18(17)32(28,29)24-9-3-4-10-24)21-20(25)15-5-8-19-22-31(26,27)12-11-23(19)14-15/h5-8,13-14H,2-4,9-12H2,1H3,(H,21,25) |
| InChIKey | FAXKBDPQOXEPRV-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 125.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |