C23H34N4O2 — CID 25448651
3-[1-[(2,4-dimethyl-6-pyrazol-1-ylphenyl)methyl]piperidin-4-yl]-N-(2-methoxyethyl)propanamide (PubChem CID 25448651) has the molecular formula C23H34N4O2 and a molecular weight of 398.55 g/mol. Its IUPAC name is 3-[1-[(2,4-dimethyl-6-pyrazol-1-ylphenyl)methyl]piperidin-4-yl]-N-(2-methoxyethyl)propanamide.
| Compound Name | 3-[1-[(2,4-dimethyl-6-pyrazol-1-ylphenyl)methyl]piperidin-4-yl]-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 25448651 |
| Molecular Formula | C23H34N4O2 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | 3-[1-[(2,4-dimethyl-6-pyrazol-1-ylphenyl)methyl]piperidin-4-yl]-N-(2-methoxyethyl)propanamide |
| SMILES | COCCNC(=O)CCC1CCN(Cc2c(C)cc(C)cc2-n2cccn2)CC1 |
| InChI | InChI=1S/C23H34N4O2/c1-18-15-19(2)21(22(16-18)27-11-4-9-25-27)17-26-12-7-20(8-13-26)5-6-23(28)24-10-14-29-3/h4,9,11,15-16,20H,5-8,10,12-14,17H2,1-3H3,(H,24,28) |
| InChIKey | WKYFWJKTDKOCRK-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|