C19H24F3NO4S — CID 25452008
ethyl 1-prop-2-enylsulfonyl-4-[[3-(trifluoromethyl)phenyl]methyl]piperidine-4-carboxylate (PubChem CID 25452008) has the molecular formula C19H24F3NO4S and a molecular weight of 419.47 g/mol. Its IUPAC name is ethyl 1-prop-2-enylsulfonyl-4-[[3-(trifluoromethyl)phenyl]methyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-prop-2-enylsulfonyl-4-[[3-(trifluoromethyl)phenyl]methyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 25452008 |
| Molecular Formula | C19H24F3NO4S |
| Molecular Weight | 419.47 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | ethyl 1-prop-2-enylsulfonyl-4-[[3-(trifluoromethyl)phenyl]methyl]piperidine-4-carboxylate |
| SMILES | C=CCS(=O)(=O)N1CCC(Cc2cccc(C(F)(F)F)c2)(C(=O)OCC)CC1 |
| InChI | InChI=1S/C19H24F3NO4S/c1-3-12-28(25,26)23-10-8-18(9-11-23,17(24)27-4-2)14-15-6-5-7-16(13-15)19(20,21)22/h3,5-7,13H,1,4,8-12,14H2,2H3 |
| InChIKey | ZHSFARSYKDUWCZ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.47 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|