C16H20F3NO — CID 168912860
1-prop-2-enyl-4-[[3-(trifluoromethyl)phenyl]methyl]piperidin-4-ol (PubChem CID 168912860) has the molecular formula C16H20F3NO and a molecular weight of 299.34 g/mol. Its IUPAC name is 1-prop-2-enyl-4-[[3-(trifluoromethyl)phenyl]methyl]piperidin-4-ol.
| Compound Name | 1-prop-2-enyl-4-[[3-(trifluoromethyl)phenyl]methyl]piperidin-4-ol |
|---|---|
| PubChem CID | 168912860 |
| Molecular Formula | C16H20F3NO |
| Molecular Weight | 299.34 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 1-prop-2-enyl-4-[[3-(trifluoromethyl)phenyl]methyl]piperidin-4-ol |
| SMILES | C=CCN1CCC(O)(Cc2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C16H20F3NO/c1-2-8-20-9-6-15(21,7-10-20)12-13-4-3-5-14(11-13)16(17,18)19/h2-5,11,21H,1,6-10,12H2 |
| InChIKey | YPPJZQHTYWCVLN-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.34 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|