C24H32N2O4 — CID 25456293
2-(1-cyclopentylpiperidin-4-yl)oxy-5-methoxy-N-[(5-methylfuran-2-yl)methyl]benzamide (PubChem CID 25456293) has the molecular formula C24H32N2O4 and a molecular weight of 412.53 g/mol. Its IUPAC name is 2-(1-cyclopentylpiperidin-4-yl)oxy-5-methoxy-N-[(5-methylfuran-2-yl)methyl]benzamide.
| Compound Name | 2-(1-cyclopentylpiperidin-4-yl)oxy-5-methoxy-N-[(5-methylfuran-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 25456293 |
| Molecular Formula | C24H32N2O4 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | 2-(1-cyclopentylpiperidin-4-yl)oxy-5-methoxy-N-[(5-methylfuran-2-yl)methyl]benzamide |
| SMILES | COc1ccc(OC2CCN(C3CCCC3)CC2)c(C(=O)NCc2ccc(C)o2)c1 |
| InChI | InChI=1S/C24H32N2O4/c1-17-7-8-21(29-17)16-25-24(27)22-15-20(28-2)9-10-23(22)30-19-11-13-26(14-12-19)18-5-3-4-6-18/h7-10,15,18-19H,3-6,11-14,16H2,1-2H3,(H,25,27) |
| InChIKey | RTXPUHZHRLIPEI-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 63.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |