C24H38N2O4 — CID 42403030
2-[1-[(1R)-3,3-dimethylcyclohexyl]piperidin-4-yl]oxy-4-methoxy-N-(2-methoxyethyl)benzamide (PubChem CID 42403030) has the molecular formula C24H38N2O4 and a molecular weight of 418.58 g/mol. Its IUPAC name is 2-[1-[(1R)-3,3-dimethylcyclohexyl]piperidin-4-yl]oxy-4-methoxy-N-(2-methoxyethyl)benzamide.
| Compound Name | 2-[1-[(1R)-3,3-dimethylcyclohexyl]piperidin-4-yl]oxy-4-methoxy-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 42403030 |
| Molecular Formula | C24H38N2O4 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.28 |
| IUPAC Name | 2-[1-[(1R)-3,3-dimethylcyclohexyl]piperidin-4-yl]oxy-4-methoxy-N-(2-methoxyethyl)benzamide |
| SMILES | COCCNC(=O)c1ccc(OC)cc1OC1CCN([C@@H]2CCCC(C)(C)C2)CC1 |
| InChI | InChI=1S/C24H38N2O4/c1-24(2)11-5-6-18(17-24)26-13-9-19(10-14-26)30-22-16-20(29-4)7-8-21(22)23(27)25-12-15-28-3/h7-8,16,18-19H,5-6,9-15,17H2,1-4H3,(H,25,27)/t18-/m1/s1 |
| InChIKey | CWFYGKSBPLIVAP-GOSISDBHSA-N |
| XLogP | 3.88 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|