C23H28ClFN2O4 — CID 42298282
2-[1-[(2-chloro-4-fluorophenyl)methyl]piperidin-4-yl]oxy-4-methoxy-N-(2-methoxyethyl)benzamide (PubChem CID 42298282) has the molecular formula C23H28ClFN2O4 and a molecular weight of 450.94 g/mol. Its IUPAC name is 2-[1-[(2-chloro-4-fluorophenyl)methyl]piperidin-4-yl]oxy-4-methoxy-N-(2-methoxyethyl)benzamide.
| Compound Name | 2-[1-[(2-chloro-4-fluorophenyl)methyl]piperidin-4-yl]oxy-4-methoxy-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 42298282 |
| Molecular Formula | C23H28ClFN2O4 |
| Molecular Weight | 450.94 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | 2-[1-[(2-chloro-4-fluorophenyl)methyl]piperidin-4-yl]oxy-4-methoxy-N-(2-methoxyethyl)benzamide |
| SMILES | COCCNC(=O)c1ccc(OC)cc1OC1CCN(Cc2ccc(F)cc2Cl)CC1 |
| InChI | InChI=1S/C23H28ClFN2O4/c1-29-12-9-26-23(28)20-6-5-19(30-2)14-22(20)31-18-7-10-27(11-8-18)15-16-3-4-17(25)13-21(16)24/h3-6,13-14,18H,7-12,15H2,1-2H3,(H,26,28) |
| InChIKey | SGWSYDXQVSAJPE-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.94 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|