C22H32N4O4 — CID 25457226
2-[1-[(1-ethylpyrazol-4-yl)methyl]piperidin-4-yl]oxy-4-methoxy-N-(2-methoxyethyl)benzamide (PubChem CID 25457226) has the molecular formula C22H32N4O4 and a molecular weight of 416.52 g/mol. Its IUPAC name is 2-[1-[(1-ethylpyrazol-4-yl)methyl]piperidin-4-yl]oxy-4-methoxy-N-(2-methoxyethyl)benzamide.
| Compound Name | 2-[1-[(1-ethylpyrazol-4-yl)methyl]piperidin-4-yl]oxy-4-methoxy-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 25457226 |
| Molecular Formula | C22H32N4O4 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | 2-[1-[(1-ethylpyrazol-4-yl)methyl]piperidin-4-yl]oxy-4-methoxy-N-(2-methoxyethyl)benzamide |
| SMILES | CCn1cc(CN2CCC(Oc3cc(OC)ccc3C(=O)NCCOC)CC2)cn1 |
| InChI | InChI=1S/C22H32N4O4/c1-4-26-16-17(14-24-26)15-25-10-7-18(8-11-25)30-21-13-19(29-3)5-6-20(21)22(27)23-9-12-28-2/h5-6,13-14,16,18H,4,7-12,15H2,1-3H3,(H,23,27) |
| InChIKey | LLAZTYDODUGGNY-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 77.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|