C20H32N2O4S — CID 26316423
4-methoxy-N-(2-methoxyethyl)-2-[1-[(2S)-1-methylsulfanylpropan-2-yl]piperidin-4-yl]oxybenzamide (PubChem CID 26316423) has the molecular formula C20H32N2O4S and a molecular weight of 396.55 g/mol. Its IUPAC name is 4-methoxy-N-(2-methoxyethyl)-2-[1-[(2S)-1-methylsulfanylpropan-2-yl]piperidin-4-yl]oxybenzamide.
| Compound Name | 4-methoxy-N-(2-methoxyethyl)-2-[1-[(2S)-1-methylsulfanylpropan-2-yl]piperidin-4-yl]oxybenzamide |
|---|---|
| PubChem CID | 26316423 |
| Molecular Formula | C20H32N2O4S |
| Molecular Weight | 396.55 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | 4-methoxy-N-(2-methoxyethyl)-2-[1-[(2S)-1-methylsulfanylpropan-2-yl]piperidin-4-yl]oxybenzamide |
| SMILES | COCCNC(=O)c1ccc(OC)cc1OC1CCN([C@@H](C)CSC)CC1 |
| InChI | InChI=1S/C20H32N2O4S/c1-15(14-27-4)22-10-7-16(8-11-22)26-19-13-17(25-3)5-6-18(19)20(23)21-9-12-24-2/h5-6,13,15-16H,7-12,14H2,1-4H3,(H,21,23)/t15-/m0/s1 |
| InChIKey | LJVABRPDKDOMFF-HNNXBMFYSA-N |
| XLogP | 2.67 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.55 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|