C22H31ClN4O4 — CID 26406468
2-[1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]oxy-4-methoxy-N-(2-methoxyethyl)benzamide (PubChem CID 26406468) has the molecular formula C22H31ClN4O4 and a molecular weight of 450.97 g/mol. Its IUPAC name is 2-[1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]oxy-4-methoxy-N-(2-methoxyethyl)benzamide.
| Compound Name | 2-[1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]oxy-4-methoxy-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 26406468 |
| Molecular Formula | C22H31ClN4O4 |
| Molecular Weight | 450.97 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | 2-[1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]oxy-4-methoxy-N-(2-methoxyethyl)benzamide |
| SMILES | COCCNC(=O)c1ccc(OC)cc1OC1CCN(Cc2c(C)nn(C)c2Cl)CC1 |
| InChI | InChI=1S/C22H31ClN4O4/c1-15-19(21(23)26(2)25-15)14-27-10-7-16(8-11-27)31-20-13-17(30-4)5-6-18(20)22(28)24-9-12-29-3/h5-6,13,16H,7-12,14H2,1-4H3,(H,24,28) |
| InChIKey | JZBXGPGCLXYQKA-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 77.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.97 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|