C23H36N2O4 — CID 25369057
4-methoxy-N-(2-methoxyethyl)-2-[1-[(2S)-5-methylhex-5-en-2-yl]piperidin-4-yl]oxybenzamide (PubChem CID 25369057) has the molecular formula C23H36N2O4 and a molecular weight of 404.55 g/mol. Its IUPAC name is 4-methoxy-N-(2-methoxyethyl)-2-[1-[(2S)-5-methylhex-5-en-2-yl]piperidin-4-yl]oxybenzamide.
| Compound Name | 4-methoxy-N-(2-methoxyethyl)-2-[1-[(2S)-5-methylhex-5-en-2-yl]piperidin-4-yl]oxybenzamide |
|---|---|
| PubChem CID | 25369057 |
| Molecular Formula | C23H36N2O4 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.27 |
| IUPAC Name | 4-methoxy-N-(2-methoxyethyl)-2-[1-[(2S)-5-methylhex-5-en-2-yl]piperidin-4-yl]oxybenzamide |
| SMILES | C=C(C)CC[C@H](C)N1CCC(Oc2cc(OC)ccc2C(=O)NCCOC)CC1 |
| InChI | InChI=1S/C23H36N2O4/c1-17(2)6-7-18(3)25-13-10-19(11-14-25)29-22-16-20(28-5)8-9-21(22)23(26)24-12-15-27-4/h8-9,16,18-19H,1,6-7,10-15H2,2-5H3,(H,24,26)/t18-/m0/s1 |
| InChIKey | XDJBBGSJSRFRIR-SFHVURJKSA-N |
| XLogP | 3.66 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|