C24H36N4O4 — CID 26404278
4-methoxy-N-(2-methoxyethyl)-2-[1-[(5-methyl-1-propylpyrazol-4-yl)methyl]piperidin-4-yl]oxybenzamide (PubChem CID 26404278) has the molecular formula C24H36N4O4 and a molecular weight of 444.58 g/mol. Its IUPAC name is 4-methoxy-N-(2-methoxyethyl)-2-[1-[(5-methyl-1-propylpyrazol-4-yl)methyl]piperidin-4-yl]oxybenzamide.
| Compound Name | 4-methoxy-N-(2-methoxyethyl)-2-[1-[(5-methyl-1-propylpyrazol-4-yl)methyl]piperidin-4-yl]oxybenzamide |
|---|---|
| PubChem CID | 26404278 |
| Molecular Formula | C24H36N4O4 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.27 |
| IUPAC Name | 4-methoxy-N-(2-methoxyethyl)-2-[1-[(5-methyl-1-propylpyrazol-4-yl)methyl]piperidin-4-yl]oxybenzamide |
| SMILES | CCCn1ncc(CN2CCC(Oc3cc(OC)ccc3C(=O)NCCOC)CC2)c1C |
| InChI | InChI=1S/C24H36N4O4/c1-5-11-28-18(2)19(16-26-28)17-27-12-8-20(9-13-27)32-23-15-21(31-4)6-7-22(23)24(29)25-10-14-30-3/h6-7,15-16,20H,5,8-14,17H2,1-4H3,(H,25,29) |
| InChIKey | YPIBGMGJCSLAKV-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 77.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|