C20H33NO4 — CID 25461112
ethyl 4-(2-methoxyethyl)-1-[(3S)-3-(5-methylfuran-2-yl)butyl]piperidine-4-carboxylate (PubChem CID 25461112) has the molecular formula C20H33NO4 and a molecular weight of 351.49 g/mol. Its IUPAC name is ethyl 4-(2-methoxyethyl)-1-[(3S)-3-(5-methylfuran-2-yl)butyl]piperidine-4-carboxylate.
| Compound Name | ethyl 4-(2-methoxyethyl)-1-[(3S)-3-(5-methylfuran-2-yl)butyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 25461112 |
| Molecular Formula | C20H33NO4 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.24 |
| IUPAC Name | ethyl 4-(2-methoxyethyl)-1-[(3S)-3-(5-methylfuran-2-yl)butyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1(CCOC)CCN(CC[C@H](C)c2ccc(C)o2)CC1 |
| InChI | InChI=1S/C20H33NO4/c1-5-24-19(22)20(11-15-23-4)9-13-21(14-10-20)12-8-16(2)18-7-6-17(3)25-18/h6-7,16H,5,8-15H2,1-4H3/t16-/m0/s1 |
| InChIKey | QTEFBZJUAJRWLT-INIZCTEOSA-N |
| XLogP | 3.76 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |