C26H36N4O4 — CID 26230801
1-(3-methoxypropyl)-8-[(3R)-3-(5-methylfuran-2-yl)butyl]-3-(pyridin-2-ylmethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 26230801) has the molecular formula C26H36N4O4 and a molecular weight of 468.60 g/mol. Its IUPAC name is 1-(3-methoxypropyl)-8-[(3R)-3-(5-methylfuran-2-yl)butyl]-3-(pyridin-2-ylmethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 1-(3-methoxypropyl)-8-[(3R)-3-(5-methylfuran-2-yl)butyl]-3-(pyridin-2-ylmethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 26230801 |
| Molecular Formula | C26H36N4O4 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.27 |
| IUPAC Name | 1-(3-methoxypropyl)-8-[(3R)-3-(5-methylfuran-2-yl)butyl]-3-(pyridin-2-ylmethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | COCCCN1C(=O)N(Cc2ccccn2)C(=O)C12CCN(CC[C@@H](C)c1ccc(C)o1)CC2 |
| InChI | InChI=1S/C26H36N4O4/c1-20(23-9-8-21(2)34-23)10-15-28-16-11-26(12-17-28)24(31)29(19-22-7-4-5-13-27-22)25(32)30(26)14-6-18-33-3/h4-5,7-9,13,20H,6,10-12,14-19H2,1-3H3/t20-/m1/s1 |
| InChIKey | CSBJLAJZTYHNDY-HXUWFJFHSA-N |
| XLogP | 3.81 |
| TPSA | 79.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|