C24H28ClFN4O3 — CID 26224071
8-[(2-chloro-6-fluorophenyl)methyl]-1-(3-methoxypropyl)-3-(pyridin-2-ylmethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 26224071) has the molecular formula C24H28ClFN4O3 and a molecular weight of 474.96 g/mol. Its IUPAC name is 8-[(2-chloro-6-fluorophenyl)methyl]-1-(3-methoxypropyl)-3-(pyridin-2-ylmethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-[(2-chloro-6-fluorophenyl)methyl]-1-(3-methoxypropyl)-3-(pyridin-2-ylmethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 26224071 |
| Molecular Formula | C24H28ClFN4O3 |
| Molecular Weight | 474.96 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | 8-[(2-chloro-6-fluorophenyl)methyl]-1-(3-methoxypropyl)-3-(pyridin-2-ylmethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | COCCCN1C(=O)N(Cc2ccccn2)C(=O)C12CCN(Cc1c(F)cccc1Cl)CC2 |
| InChI | InChI=1S/C24H28ClFN4O3/c1-33-15-5-12-30-23(32)29(16-18-6-2-3-11-27-18)22(31)24(30)9-13-28(14-10-24)17-19-20(25)7-4-8-21(19)26/h2-4,6-8,11H,5,9-10,12-17H2,1H3 |
| InChIKey | ZZZIACUPIZCEDA-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 65.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.96 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|