C24H32N2O5S — CID 2546237
[2-[2-[(2S)-butan-2-yl]anilino]-2-oxoethyl] 3-(diethylsulfamoyl)-4-methylbenzoate (PubChem CID 2546237) has the molecular formula C24H32N2O5S and a molecular weight of 460.60 g/mol. Its IUPAC name is [2-[2-[(2S)-butan-2-yl]anilino]-2-oxoethyl] 3-(diethylsulfamoyl)-4-methylbenzoate.
| Compound Name | [2-[2-[(2S)-butan-2-yl]anilino]-2-oxoethyl] 3-(diethylsulfamoyl)-4-methylbenzoate |
|---|---|
| PubChem CID | 2546237 |
| Molecular Formula | C24H32N2O5S |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | [2-[2-[(2S)-butan-2-yl]anilino]-2-oxoethyl] 3-(diethylsulfamoyl)-4-methylbenzoate |
| SMILES | CC[C@H](C)c1ccccc1NC(=O)COC(=O)c1ccc(C)c(S(=O)(=O)N(CC)CC)c1 |
| InChI | InChI=1S/C24H32N2O5S/c1-6-17(4)20-11-9-10-12-21(20)25-23(27)16-31-24(28)19-14-13-18(5)22(15-19)32(29,30)26(7-2)8-3/h9-15,17H,6-8,16H2,1-5H3,(H,25,27)/t17-/m0/s1 |
| InChIKey | NBCQZJDNUHCWPK-KRWDZBQOSA-N |
| XLogP | 4.33 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |