C9H9ClN4OS — CID 2546244
4-amino-3-[(4-chlorophenoxy)methyl]-1H-1,2,4-triazole-5-thione (PubChem CID 2546244) has the molecular formula C9H9ClN4OS and a molecular weight of 256.72 g/mol. Its IUPAC name is 4-amino-3-[(4-chlorophenoxy)methyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-amino-3-[(4-chlorophenoxy)methyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 2546244 |
| Molecular Formula | C9H9ClN4OS |
| Molecular Weight | 256.72 g/mol |
| Exact Mass | 256.02 |
| IUPAC Name | 4-amino-3-[(4-chlorophenoxy)methyl]-1H-1,2,4-triazole-5-thione |
| SMILES | Nn1c(COc2ccc(Cl)cc2)n[nH]c1=S |
| InChI | InChI=1S/C9H9ClN4OS/c10-6-1-3-7(4-2-6)15-5-8-12-13-9(16)14(8)11/h1-4H,5,11H2,(H,13,16) |
| InChIKey | VKXMIAZOMPVHIM-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 68.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.72 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|