C23H29N4O+ — CID 2546572
(2R)-2-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)-N-(9-ethylcarbazol-3-yl)propanamide (PubChem CID 2546572) has the molecular formula C23H29N4O+ and a molecular weight of 377.51 g/mol. Its IUPAC name is (2R)-2-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)-N-(9-ethylcarbazol-3-yl)propanamide.
| Compound Name | (2R)-2-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)-N-(9-ethylcarbazol-3-yl)propanamide |
|---|---|
| PubChem CID | 2546572 |
| Molecular Formula | C23H29N4O+ |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.23 |
| IUPAC Name | (2R)-2-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)-N-(9-ethylcarbazol-3-yl)propanamide |
| SMILES | CCn1c2ccccc2c2cc(NC(=O)[C@@H](C)[N+]34CCN(CC3)CC4)ccc21 |
| InChI | InChI=1S/C23H28N4O/c1-3-26-21-7-5-4-6-19(21)20-16-18(8-9-22(20)26)24-23(28)17(2)27-13-10-25(11-14-27)12-15-27/h4-9,16-17H,3,10-15H2,1-2H3/p+1/t17-/m1/s1 |
| InChIKey | OJAXJVRHCFCLJW-QGZVFWFLSA-O |
| XLogP | 3.29 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|