C27H27N3O4S — CID 25467498
2-[benzyl-[(E)-2-phenylethenyl]sulfonylamino]-N-[2-(2-oxopyrrolidin-1-yl)phenyl]acetamide (PubChem CID 25467498) has the molecular formula C27H27N3O4S and a molecular weight of 489.60 g/mol. Its IUPAC name is 2-[benzyl-[(E)-2-phenylethenyl]sulfonylamino]-N-[2-(2-oxopyrrolidin-1-yl)phenyl]acetamide.
| Compound Name | 2-[benzyl-[(E)-2-phenylethenyl]sulfonylamino]-N-[2-(2-oxopyrrolidin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 25467498 |
| Molecular Formula | C27H27N3O4S |
| Molecular Weight | 489.60 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | 2-[benzyl-[(E)-2-phenylethenyl]sulfonylamino]-N-[2-(2-oxopyrrolidin-1-yl)phenyl]acetamide |
| SMILES | O=C(CN(Cc1ccccc1)S(=O)(=O)/C=C/c1ccccc1)Nc1ccccc1N1CCCC1=O |
| InChI | InChI=1S/C27H27N3O4S/c31-26(28-24-14-7-8-15-25(24)30-18-9-16-27(30)32)21-29(20-23-12-5-2-6-13-23)35(33,34)19-17-22-10-3-1-4-11-22/h1-8,10-15,17,19H,9,16,18,20-21H2,(H,28,31)/b19-17+ |
| InChIKey | MVFVYYYPZGEWFI-HTXNQAPBSA-N |
| XLogP | 4.25 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.60 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |