C13H15FN4S2 — CID 25468385
3-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-1,3,4-thiadiazole-2-thione (PubChem CID 25468385) has the molecular formula C13H15FN4S2 and a molecular weight of 310.42 g/mol. Its IUPAC name is 3-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-1,3,4-thiadiazole-2-thione.
| Compound Name | 3-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 25468385 |
| Molecular Formula | C13H15FN4S2 |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 3-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-1,3,4-thiadiazole-2-thione |
| SMILES | Fc1ccccc1N1CCN(Cn2ncsc2=S)CC1 |
| InChI | InChI=1S/C13H15FN4S2/c14-11-3-1-2-4-12(11)17-7-5-16(6-8-17)10-18-13(19)20-9-15-18/h1-4,9H,5-8,10H2 |
| InChIKey | YBSLUMKVMKVHMY-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|