C20H18FNO3 — CID 25468956
4-(4-fluorophenoxy)-N-(4-hydroxynaphthalen-1-yl)butanamide (PubChem CID 25468956) has the molecular formula C20H18FNO3 and a molecular weight of 339.37 g/mol. Its IUPAC name is 4-(4-fluorophenoxy)-N-(4-hydroxynaphthalen-1-yl)butanamide.
| Compound Name | 4-(4-fluorophenoxy)-N-(4-hydroxynaphthalen-1-yl)butanamide |
|---|---|
| PubChem CID | 25468956 |
| Molecular Formula | C20H18FNO3 |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 4-(4-fluorophenoxy)-N-(4-hydroxynaphthalen-1-yl)butanamide |
| SMILES | O=C(CCCOc1ccc(F)cc1)Nc1ccc(O)c2ccccc12 |
| InChI | InChI=1S/C20H18FNO3/c21-14-7-9-15(10-8-14)25-13-3-6-20(24)22-18-11-12-19(23)17-5-2-1-4-16(17)18/h1-2,4-5,7-12,23H,3,6,13H2,(H,22,24) |
| InChIKey | BKHYAUBIWTWPDM-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|