C24H29N7O2 — CID 25470934
1-[[4-amino-6-(2-ethylanilino)-1,3,5-triazin-2-yl]methyl]-N-(2-hydroxyphenyl)piperidine-4-carboxamide (PubChem CID 25470934) has the molecular formula C24H29N7O2 and a molecular weight of 447.54 g/mol. Its IUPAC name is 1-[[4-amino-6-(2-ethylanilino)-1,3,5-triazin-2-yl]methyl]-N-(2-hydroxyphenyl)piperidine-4-carboxamide.
| Compound Name | 1-[[4-amino-6-(2-ethylanilino)-1,3,5-triazin-2-yl]methyl]-N-(2-hydroxyphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 25470934 |
| Molecular Formula | C24H29N7O2 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | 1-[[4-amino-6-(2-ethylanilino)-1,3,5-triazin-2-yl]methyl]-N-(2-hydroxyphenyl)piperidine-4-carboxamide |
| SMILES | CCc1ccccc1Nc1nc(N)nc(CN2CCC(C(=O)Nc3ccccc3O)CC2)n1 |
| InChI | InChI=1S/C24H29N7O2/c1-2-16-7-3-4-8-18(16)27-24-29-21(28-23(25)30-24)15-31-13-11-17(12-14-31)22(33)26-19-9-5-6-10-20(19)32/h3-10,17,32H,2,11-15H2,1H3,(H,26,33)(H3,25,27,28,29,30) |
| InChIKey | MAQXERVJYUJPNK-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 129.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|