C24H26N4O4 — CID 25479546
N-(furan-2-ylmethyl)-4-(4-methylpiperidin-1-yl)-3-nitro-N-(pyridin-3-ylmethyl)benzamide (PubChem CID 25479546) has the molecular formula C24H26N4O4 and a molecular weight of 434.50 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-4-(4-methylpiperidin-1-yl)-3-nitro-N-(pyridin-3-ylmethyl)benzamide.
| Compound Name | N-(furan-2-ylmethyl)-4-(4-methylpiperidin-1-yl)-3-nitro-N-(pyridin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 25479546 |
| Molecular Formula | C24H26N4O4 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | N-(furan-2-ylmethyl)-4-(4-methylpiperidin-1-yl)-3-nitro-N-(pyridin-3-ylmethyl)benzamide |
| SMILES | CC1CCN(c2ccc(C(=O)N(Cc3cccnc3)Cc3ccco3)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C24H26N4O4/c1-18-8-11-26(12-9-18)22-7-6-20(14-23(22)28(30)31)24(29)27(17-21-5-3-13-32-21)16-19-4-2-10-25-15-19/h2-7,10,13-15,18H,8-9,11-12,16-17H2,1H3 |
| InChIKey | WSKYYZRMORZKMN-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 92.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|