C19H25ClFN3O2 — CID 25479964
(3aS,6aR)-5-[(2-chloro-6-fluorophenyl)methyl]-3-(2-piperidin-1-ylethyl)-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,3]oxazol-2-one (PubChem CID 25479964) has the molecular formula C19H25ClFN3O2 and a molecular weight of 381.88 g/mol. Its IUPAC name is (3aS,6aR)-5-[(2-chloro-6-fluorophenyl)methyl]-3-(2-piperidin-1-ylethyl)-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,3]oxazol-2-one.
| Compound Name | (3aS,6aR)-5-[(2-chloro-6-fluorophenyl)methyl]-3-(2-piperidin-1-ylethyl)-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,3]oxazol-2-one |
|---|---|
| PubChem CID | 25479964 |
| Molecular Formula | C19H25ClFN3O2 |
| Molecular Weight | 381.88 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | (3aS,6aR)-5-[(2-chloro-6-fluorophenyl)methyl]-3-(2-piperidin-1-ylethyl)-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,3]oxazol-2-one |
| SMILES | O=C1O[C@@H]2CN(Cc3c(F)cccc3Cl)C[C@@H]2N1CCN1CCCCC1 |
| InChI | InChI=1S/C19H25ClFN3O2/c20-15-5-4-6-16(21)14(15)11-23-12-17-18(13-23)26-19(25)24(17)10-9-22-7-2-1-3-8-22/h4-6,17-18H,1-3,7-13H2/t17-,18+/m0/s1 |
| InChIKey | ANCGFPBLWXHZGE-ZWKOTPCHSA-N |
| XLogP | 2.97 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.88 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |