C17H20N4O4 — CID 25482818
(6S,10R)-3-[[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]methyl]-6,10-dimethyl-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 25482818) has the molecular formula C17H20N4O4 and a molecular weight of 344.37 g/mol. Its IUPAC name is (6S,10R)-3-[[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]methyl]-6,10-dimethyl-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | (6S,10R)-3-[[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]methyl]-6,10-dimethyl-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 25482818 |
| Molecular Formula | C17H20N4O4 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | (6S,10R)-3-[[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]methyl]-6,10-dimethyl-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | C[C@@H]1CCC[C@H](C)C12NC(=O)N(Cc1nc(-c3ccco3)no1)C2=O |
| InChI | InChI=1S/C17H20N4O4/c1-10-5-3-6-11(2)17(10)15(22)21(16(23)19-17)9-13-18-14(20-25-13)12-7-4-8-24-12/h4,7-8,10-11H,3,5-6,9H2,1-2H3,(H,19,23)/t10-,11+,17? |
| InChIKey | WWJSYTVFLZTTSI-DNJLBHFNSA-N |
| XLogP | 2.58 |
| TPSA | 101.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|