C23H25N3O5 — CID 25483111
N-(1,3-benzodioxol-5-ylmethyl)-2-[(4R)-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-N-ethylacetamide (PubChem CID 25483111) has the molecular formula C23H25N3O5 and a molecular weight of 423.47 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-[(4R)-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-N-ethylacetamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-[(4R)-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-N-ethylacetamide |
|---|---|
| PubChem CID | 25483111 |
| Molecular Formula | C23H25N3O5 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-[(4R)-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-N-ethylacetamide |
| SMILES | CCN(Cc1ccc2c(c1)OCO2)C(=O)CN1C(=O)N[C@H](CCc2ccccc2)C1=O |
| InChI | InChI=1S/C23H25N3O5/c1-2-25(13-17-9-11-19-20(12-17)31-15-30-19)21(27)14-26-22(28)18(24-23(26)29)10-8-16-6-4-3-5-7-16/h3-7,9,11-12,18H,2,8,10,13-15H2,1H3,(H,24,29)/t18-/m1/s1 |
| InChIKey | CWDXUIFFSFLDRR-GOSISDBHSA-N |
| XLogP | 2.32 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|