C19H16FN7O3S — CID 25487898
3-[(2-fluorophenyl)methyl]-5-[(1S)-1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl]sulfanyl-1,2,4-triazol-4-amine (PubChem CID 25487898) has the molecular formula C19H16FN7O3S and a molecular weight of 441.45 g/mol. Its IUPAC name is 3-[(2-fluorophenyl)methyl]-5-[(1S)-1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl]sulfanyl-1,2,4-triazol-4-amine.
| Compound Name | 3-[(2-fluorophenyl)methyl]-5-[(1S)-1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl]sulfanyl-1,2,4-triazol-4-amine |
|---|---|
| PubChem CID | 25487898 |
| Molecular Formula | C19H16FN7O3S |
| Molecular Weight | 441.45 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | 3-[(2-fluorophenyl)methyl]-5-[(1S)-1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl]sulfanyl-1,2,4-triazol-4-amine |
| SMILES | C[C@H](Sc1nnc(Cc2ccccc2F)n1N)c1nnc(-c2ccc([N+](=O)[O-])cc2)o1 |
| InChI | InChI=1S/C19H16FN7O3S/c1-11(17-23-24-18(30-17)12-6-8-14(9-7-12)27(28)29)31-19-25-22-16(26(19)21)10-13-4-2-3-5-15(13)20/h2-9,11H,10,21H2,1H3/t11-/m0/s1 |
| InChIKey | CPGFQAIFRFQKPW-NSHDSACASA-N |
| XLogP | 3.53 |
| TPSA | 138.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.45 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|