C24H16ClFN6O3S — CID 45355310
2-[1-[[5-(2-chlorophenyl)-4-(2-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]ethyl]-5-(4-nitrophenyl)-1,3,4-oxadiazole (PubChem CID 45355310) has the molecular formula C24H16ClFN6O3S and a molecular weight of 522.95 g/mol. Its IUPAC name is 2-[1-[[5-(2-chlorophenyl)-4-(2-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]ethyl]-5-(4-nitrophenyl)-1,3,4-oxadiazole.
| Compound Name | 2-[1-[[5-(2-chlorophenyl)-4-(2-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]ethyl]-5-(4-nitrophenyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 45355310 |
| Molecular Formula | C24H16ClFN6O3S |
| Molecular Weight | 522.95 g/mol |
| Exact Mass | 522.07 |
| IUPAC Name | 2-[1-[[5-(2-chlorophenyl)-4-(2-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]ethyl]-5-(4-nitrophenyl)-1,3,4-oxadiazole |
| SMILES | CC(Sc1nnc(-c2ccccc2Cl)n1-c1ccccc1F)c1nnc(-c2ccc([N+](=O)[O-])cc2)o1 |
| InChI | InChI=1S/C24H16ClFN6O3S/c1-14(22-28-29-23(35-22)15-10-12-16(13-11-15)32(33)34)36-24-30-27-21(17-6-2-3-7-18(17)25)31(24)20-9-5-4-8-19(20)26/h2-14H,1H3 |
| InChIKey | TUMBISDAFHBJMV-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 112.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.95 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|