C23H30ClN3O2 — CID 25491544
N-[(2S)-1-[3-[benzyl(methyl)amino]propylamino]-3-methyl-1-oxobutan-2-yl]-4-chlorobenzamide (PubChem CID 25491544) has the molecular formula C23H30ClN3O2 and a molecular weight of 415.97 g/mol. Its IUPAC name is N-[(2S)-1-[3-[benzyl(methyl)amino]propylamino]-3-methyl-1-oxobutan-2-yl]-4-chlorobenzamide.
| Compound Name | N-[(2S)-1-[3-[benzyl(methyl)amino]propylamino]-3-methyl-1-oxobutan-2-yl]-4-chlorobenzamide |
|---|---|
| PubChem CID | 25491544 |
| Molecular Formula | C23H30ClN3O2 |
| Molecular Weight | 415.97 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | N-[(2S)-1-[3-[benzyl(methyl)amino]propylamino]-3-methyl-1-oxobutan-2-yl]-4-chlorobenzamide |
| SMILES | CC(C)[C@H](NC(=O)c1ccc(Cl)cc1)C(=O)NCCCN(C)Cc1ccccc1 |
| InChI | InChI=1S/C23H30ClN3O2/c1-17(2)21(26-22(28)19-10-12-20(24)13-11-19)23(29)25-14-7-15-27(3)16-18-8-5-4-6-9-18/h4-6,8-13,17,21H,7,14-16H2,1-3H3,(H,25,29)(H,26,28)/t21-/m0/s1 |
| InChIKey | OXDOIHNXBWZNIW-NRFANRHFSA-N |
| XLogP | 3.73 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.97 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|