C13H8BrF2NO3S — CID 25493883
methyl 5-[(5-bromothiophene-2-carbonyl)amino]-2,4-difluorobenzoate (PubChem CID 25493883) has the molecular formula C13H8BrF2NO3S and a molecular weight of 376.18 g/mol. Its IUPAC name is methyl 5-[(5-bromothiophene-2-carbonyl)amino]-2,4-difluorobenzoate.
| Compound Name | methyl 5-[(5-bromothiophene-2-carbonyl)amino]-2,4-difluorobenzoate |
|---|---|
| PubChem CID | 25493883 |
| Molecular Formula | C13H8BrF2NO3S |
| Molecular Weight | 376.18 g/mol |
| Exact Mass | 374.94 |
| IUPAC Name | methyl 5-[(5-bromothiophene-2-carbonyl)amino]-2,4-difluorobenzoate |
| SMILES | COC(=O)c1cc(NC(=O)c2ccc(Br)s2)c(F)cc1F |
| InChI | InChI=1S/C13H8BrF2NO3S/c1-20-13(19)6-4-9(8(16)5-7(6)15)17-12(18)10-2-3-11(14)21-10/h2-5H,1H3,(H,17,18) |
| InChIKey | AJEIUAABWIXRDL-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.18 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |