C19H25N3O4 — CID 25495501
N-[2-[3-(2,5-dimethoxyphenyl)propanoylamino]ethyl]-1-methylpyrrole-2-carboxamide (PubChem CID 25495501) has the molecular formula C19H25N3O4 and a molecular weight of 359.43 g/mol. Its IUPAC name is N-[2-[3-(2,5-dimethoxyphenyl)propanoylamino]ethyl]-1-methylpyrrole-2-carboxamide.
| Compound Name | N-[2-[3-(2,5-dimethoxyphenyl)propanoylamino]ethyl]-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 25495501 |
| Molecular Formula | C19H25N3O4 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | N-[2-[3-(2,5-dimethoxyphenyl)propanoylamino]ethyl]-1-methylpyrrole-2-carboxamide |
| SMILES | COc1ccc(OC)c(CCC(=O)NCCNC(=O)c2cccn2C)c1 |
| InChI | InChI=1S/C19H25N3O4/c1-22-12-4-5-16(22)19(24)21-11-10-20-18(23)9-6-14-13-15(25-2)7-8-17(14)26-3/h4-5,7-8,12-13H,6,9-11H2,1-3H3,(H,20,23)(H,21,24) |
| InChIKey | FAOOQKSUUSZSGR-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|