C25H24ClN3O5 — CID 25496730
4-[[2-[(7-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)amino]acetyl]amino]-N-(4-methoxyphenyl)benzamide (PubChem CID 25496730) has the molecular formula C25H24ClN3O5 and a molecular weight of 481.94 g/mol. Its IUPAC name is 4-[[2-[(7-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)amino]acetyl]amino]-N-(4-methoxyphenyl)benzamide.
| Compound Name | 4-[[2-[(7-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)amino]acetyl]amino]-N-(4-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 25496730 |
| Molecular Formula | C25H24ClN3O5 |
| Molecular Weight | 481.94 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | 4-[[2-[(7-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)amino]acetyl]amino]-N-(4-methoxyphenyl)benzamide |
| SMILES | COc1ccc(NC(=O)c2ccc(NC(=O)CNc3cc4c(cc3Cl)OCCCO4)cc2)cc1 |
| InChI | InChI=1S/C25H24ClN3O5/c1-32-19-9-7-18(8-10-19)29-25(31)16-3-5-17(6-4-16)28-24(30)15-27-21-14-23-22(13-20(21)26)33-11-2-12-34-23/h3-10,13-14,27H,2,11-12,15H2,1H3,(H,28,30)(H,29,31) |
| InChIKey | CPJCXCLMZJBINS-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.94 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|