C22H25N3OS — CID 25499114
(2R)-4-benzyl-2-[(1-methyl-5-phenylimidazol-2-yl)sulfanylmethyl]morpholine (PubChem CID 25499114) has the molecular formula C22H25N3OS and a molecular weight of 379.53 g/mol. Its IUPAC name is (2R)-4-benzyl-2-[(1-methyl-5-phenylimidazol-2-yl)sulfanylmethyl]morpholine.
| Compound Name | (2R)-4-benzyl-2-[(1-methyl-5-phenylimidazol-2-yl)sulfanylmethyl]morpholine |
|---|---|
| PubChem CID | 25499114 |
| Molecular Formula | C22H25N3OS |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | (2R)-4-benzyl-2-[(1-methyl-5-phenylimidazol-2-yl)sulfanylmethyl]morpholine |
| SMILES | Cn1c(-c2ccccc2)cnc1SC[C@H]1CN(Cc2ccccc2)CCO1 |
| InChI | InChI=1S/C22H25N3OS/c1-24-21(19-10-6-3-7-11-19)14-23-22(24)27-17-20-16-25(12-13-26-20)15-18-8-4-2-5-9-18/h2-11,14,20H,12-13,15-17H2,1H3/t20-/m1/s1 |
| InChIKey | UHPXRVVENISKNH-HXUWFJFHSA-N |
| XLogP | 4.08 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_thio_5_A(8)', 'substructure': 'N/A'} |
|---|