C15H22NO4+ — CID 2550581
[(2S)-3-(4-acetyl-2-methoxyphenoxy)-2-hydroxypropyl]-prop-2-enylazanium (PubChem CID 2550581) has the molecular formula C15H22NO4+ and a molecular weight of 280.34 g/mol. Its IUPAC name is [(2S)-3-(4-acetyl-2-methoxyphenoxy)-2-hydroxypropyl]-prop-2-enylazanium.
| Compound Name | [(2S)-3-(4-acetyl-2-methoxyphenoxy)-2-hydroxypropyl]-prop-2-enylazanium |
|---|---|
| PubChem CID | 2550581 |
| Molecular Formula | C15H22NO4+ |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | [(2S)-3-(4-acetyl-2-methoxyphenoxy)-2-hydroxypropyl]-prop-2-enylazanium |
| SMILES | C=CC[NH2+]C[C@H](O)COc1ccc(C(C)=O)cc1OC |
| InChI | InChI=1S/C15H21NO4/c1-4-7-16-9-13(18)10-20-14-6-5-12(11(2)17)8-15(14)19-3/h4-6,8,13,16,18H,1,7,9-10H2,2-3H3/p+1/t13-/m0/s1 |
| InChIKey | XTZZVXFTEVVGMJ-ZDUSSCGKSA-O |
| XLogP | 0.39 |
| TPSA | 72.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|