C12H12BrF3O3 — CID 64759126
1-[4-(2-bromo-3,3,3-trifluoropropoxy)-3-methoxyphenyl]ethanone (PubChem CID 64759126) has the molecular formula C12H12BrF3O3 and a molecular weight of 341.12 g/mol. Its IUPAC name is 1-[4-(2-bromo-3,3,3-trifluoropropoxy)-3-methoxyphenyl]ethanone.
| Compound Name | 1-[4-(2-bromo-3,3,3-trifluoropropoxy)-3-methoxyphenyl]ethanone |
|---|---|
| PubChem CID | 64759126 |
| Molecular Formula | C12H12BrF3O3 |
| Molecular Weight | 341.12 g/mol |
| Exact Mass | 339.99 |
| IUPAC Name | 1-[4-(2-bromo-3,3,3-trifluoropropoxy)-3-methoxyphenyl]ethanone |
| SMILES | COc1cc(C(C)=O)ccc1OCC(Br)C(F)(F)F |
| InChI | InChI=1S/C12H12BrF3O3/c1-7(17)8-3-4-9(10(5-8)18-2)19-6-11(13)12(14,15)16/h3-5,11H,6H2,1-2H3 |
| InChIKey | WMPSHQWVKYUXFP-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.12 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|