C19H25F3O5 — CID 97059849
[(2R)-1,1,1-trifluoro-3,3-dimethylbutan-2-yl] 4-(4-acetyl-2-methoxyphenoxy)butanoate (PubChem CID 97059849) has the molecular formula C19H25F3O5 and a molecular weight of 390.40 g/mol. Its IUPAC name is [(2R)-1,1,1-trifluoro-3,3-dimethylbutan-2-yl] 4-(4-acetyl-2-methoxyphenoxy)butanoate.
| Compound Name | [(2R)-1,1,1-trifluoro-3,3-dimethylbutan-2-yl] 4-(4-acetyl-2-methoxyphenoxy)butanoate |
|---|---|
| PubChem CID | 97059849 |
| Molecular Formula | C19H25F3O5 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | [(2R)-1,1,1-trifluoro-3,3-dimethylbutan-2-yl] 4-(4-acetyl-2-methoxyphenoxy)butanoate |
| SMILES | COc1cc(C(C)=O)ccc1OCCCC(=O)O[C@H](C(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C19H25F3O5/c1-12(23)13-8-9-14(15(11-13)25-5)26-10-6-7-16(24)27-17(18(2,3)4)19(20,21)22/h8-9,11,17H,6-7,10H2,1-5H3/t17-/m1/s1 |
| InChIKey | YSZIDLIGSYHRBK-QGZVFWFLSA-N |
| XLogP | 4.58 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|