C11H9BrF3NO2 — CID 64758305
4-(2-bromo-3,3,3-trifluoropropoxy)-3-methoxybenzonitrile (PubChem CID 64758305) has the molecular formula C11H9BrF3NO2 and a molecular weight of 324.10 g/mol. Its IUPAC name is 4-(2-bromo-3,3,3-trifluoropropoxy)-3-methoxybenzonitrile.
| Compound Name | 4-(2-bromo-3,3,3-trifluoropropoxy)-3-methoxybenzonitrile |
|---|---|
| PubChem CID | 64758305 |
| Molecular Formula | C11H9BrF3NO2 |
| Molecular Weight | 324.10 g/mol |
| Exact Mass | 322.98 |
| IUPAC Name | 4-(2-bromo-3,3,3-trifluoropropoxy)-3-methoxybenzonitrile |
| SMILES | COc1cc(C#N)ccc1OCC(Br)C(F)(F)F |
| InChI | InChI=1S/C11H9BrF3NO2/c1-17-9-4-7(5-16)2-3-8(9)18-6-10(12)11(13,14)15/h2-4,10H,6H2,1H3 |
| InChIKey | ZBDQNKDLMCXIKB-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.10 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|